CAS 130552-00-0
:A-PHENYL-2-OXAZOLEMETHANOL 97
Description:
A-Phenyl-2-oxazolemethanol, with the CAS number 130552-00-0, is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This substance typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of the phenyl group. It is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of the hydroxymethyl group suggests potential for hydrogen bonding and reactivity, making it a versatile compound in chemical applications. Additionally, its purity level of 97% indicates a high degree of refinement, which is crucial for research and industrial applications. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.
Formula:C10H9NO2
InChI:InChI=1/C10H9NO2/c12-9(10-11-6-7-13-10)8-4-2-1-3-5-8/h1-7,9,12H
SMILES:c1ccc(cc1)C(c1ncco1)O
Synonyms:- Oxazolidone-2-Yl-Phenylmethanol
- 1,3-Oxazol-2-Yl(Phenyl)Methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.