CAS 13056-38-7

L-Alanine, N-[N-[(phenylmethoxy)carbonyl]-L-histidyl]-

Description:

L-Alanine, N-[N-[(phenylmethoxy)carbonyl]-L-histidyl]- is a dipeptide derivative that combines the amino acids L-alanine and L-histidine, with a phenylmethoxycarbonyl protecting group. This compound features a peptide bond linking the two amino acids, which imparts specific biochemical properties. The presence of the phenylmethoxycarbonyl group enhances its stability and solubility, making it useful in various biochemical applications, including drug design and synthesis. The structure of this compound allows for potential interactions with biological receptors, which can be significant in pharmacological contexts. Additionally, the chirality of the amino acids contributes to its biological activity, as the L-forms are typically the biologically active forms in living organisms. Overall, this compound exemplifies the complexity of peptide chemistry and its relevance in medicinal chemistry and biochemistry.

Formula: C₁₇H₂₀N₄O₅

InChI: InChI=1S/C17H20N4O5/c1-11(16(23)24)20-15(22)14(7-13-8-18-10-19-13)21-17(25)26-9-12-5-3-2-4-6-12/h2-6,8,10-11,14H,7,9H2,1H3,(H,18,19)(H,20,22)(H,21,25)(H,23,24)/t11-,14-/m0/s1

InChI key: InChIKey=UIHDXSNRWRHJRT-FZMZJTMJSA-N

SMILES: [C@@H](CC1=CN=CN1)(NC(OCC2=CC=CC=C2)=O)C(N[C@H](C(O)=O)C)=O

Synonyms:

• Alanine, N-(N-carboxy-L-histidyl)-, N-benzyl ester, L-
• L-Alanine, N-[N-[(phenylmethoxy)carbonyl]-L-histidyl]-

Z-His-Ala-OH

CAS: 13056-38-7

Please enquire for more information about Z-His-Ala-OH including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₇H₂₀N₄O₅

Purity: Min. 95%

Molecular weight: 360.36 g/mol

Ref: 3D-FH111485