
CAS 130560-97-3
:3-chloro-4-fluorothiobenzamide
Description:
3-Chloro-4-fluorothiobenzamide is an organic compound characterized by the presence of a thiobenzamide functional group, which includes a sulfur atom bonded to a benzene ring and an amide group. The compound features a chlorine atom at the 3-position and a fluorine atom at the 4-position of the benzene ring, contributing to its unique reactivity and properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of halogens (chlorine and fluorine) can influence its electronic properties, making it potentially useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the thiobenzamide moiety may impart biological activity, making this compound of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds. As with any chemical substance, proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is essential for confirming its structure and purity.
Formula:C7H5ClFNS
InChI:InChI=1/C7H5ClFNS/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11)
SMILES:c1cc(c(cc1C(=N)S)Cl)F
Synonyms:- 3-Chloro-4-fluorobenzene-1-carbothioamide
- 3-Chloro-4-Fluorobenzenecarbothioamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Chloro-4-fluorothiobenzamide, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H5ClFNSPurity:97%Color and Shape:Yellow, Powder or lumpsMolecular weight:189.633-Chloro-4-fluorothiobenzamide
CAS:3-Chloro-4-fluorothiobenzamidePurity:≥95%Molecular weight:189.6377g/mol



