CAS 130566-25-5
:5-Chloro-2-propoxybenzenamine
Description:
5-Chloro-2-propoxybenzenamine, with the CAS number 130566-25-5, is an organic compound characterized by the presence of a chloro group and an amine functional group attached to a benzene ring. The compound features a propoxy substituent, which contributes to its hydrophobic properties. Typically, compounds of this nature exhibit moderate solubility in organic solvents and limited solubility in water due to their hydrophobic characteristics. The chloro substituent can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The amine group may also participate in hydrogen bonding, affecting the compound's physical properties such as boiling and melting points. Additionally, 5-Chloro-2-propoxybenzenamine may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and development. Safety data should be consulted to understand its toxicity and handling requirements, as with any chemical substance.
Formula:C9H12ClNO
InChI:InChI=1S/C9H12ClNO/c1-2-5-12-9-4-3-7(10)6-8(9)11/h3-4,6H,2,5,11H2,1H3
InChI key:InChIKey=UJEYTDFYQZDIKY-UHFFFAOYSA-N
SMILES:O(CCC)C1=C(N)C=C(Cl)C=C1
Synonyms:- Benzenamine, 5-chloro-2-propoxy-
- 5-Chloro-2-propoxybenzenamine
- 5-Chloro-2-(propoxy)aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.