CymitQuimica logo

CAS 130566-58-4

:

Benzoic acid, 2-[4-[2-(1-piperidinyl)ethoxy]benzoyl]-

Description:
Benzoic acid, 2-[4-[2-(1-piperidinyl)ethoxy]benzoyl]- is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a piperidine-derived substituent. This compound features a piperidinyl group, which contributes to its potential biological activity, and an ethoxy linkage that enhances its solubility and reactivity. The presence of the benzoic acid functional group suggests that it may exhibit acidic properties, while the aromatic rings can provide stability and influence its interaction with biological targets. This compound is likely to be of interest in medicinal chemistry due to its potential applications in drug development, particularly in the design of pharmaceuticals that target specific biological pathways. Its CAS number, 130566-58-4, allows for easy identification and reference in chemical databases. Overall, the unique combination of functional groups in this compound may lead to interesting pharmacological properties, warranting further investigation into its applications and mechanisms of action.
Formula:C21H23NO4
InChI:InChI=1S/C21H23NO4/c23-20(18-6-2-3-7-19(18)21(24)25)16-8-10-17(11-9-16)26-15-14-22-12-4-1-5-13-22/h2-3,6-11H,1,4-5,12-15H2,(H,24,25)
InChI key:GCJCKBKILAIZKT-UHFFFAOYSA-N
SMILES:C1CCN(CC1)CCOC2=CC=C(C=C2)C(=O)C3=CC=CC=C3C(=O)O
Found 5 products.