CAS 13057-65-3
:beta-(2-methoxyphenoxy)lactic acid
Description:
Beta-(2-methoxyphenoxy)lactic acid, with the CAS number 13057-65-3, is an organic compound characterized by its unique structure, which includes a lactic acid moiety linked to a 2-methoxyphenoxy group. This compound typically exhibits properties associated with both phenolic and carboxylic acid functionalities, contributing to its potential solubility in polar solvents and its reactivity in various chemical reactions. It may display moderate acidity due to the presence of the carboxylic acid group, while the methoxyphenyl group can influence its hydrophobic characteristics and biological activity. The compound is of interest in medicinal chemistry and may have applications in pharmaceuticals or as an intermediate in organic synthesis. Its specific interactions, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C10H12O5
InChI:InChI=1/C10H12O5/c1-14-8-4-2-3-5-9(8)15-6-7(11)10(12)13/h2-5,7,11H,6H2,1H3,(H,12,13)
SMILES:COc1ccccc1OCC(C(=O)O)O
Synonyms:- Propanoic acid, 2-hydroxy-3-(2-methoxyphenoxy)-
- 2-Hydroxy-3-(2-Methoxyphenoxy)Propanoic Acid
- beta-(2-Methoxyphenoxy)lactic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Propanoic acid, 2-hydroxy-3-(2-methoxyphenoxy)-
CAS:Formula:C10H12O5Color and Shape:SolidMolecular weight:212.1993Guaifenesin Metabolite (Glyceryl Guaiacolate Metabolite, Ranolazine Metabolite CVT-4786)
CAS:Formula:C10H12O5Color and Shape:White To Off-White SolidMolecular weight:212.203-(2-Methoxyphenoxy) Lactic Acid
CAS:Controlled ProductApplications 3-(2-Methoxyphenoxy) Lactic Acid is a metabolite of the Guaifenesin (G810500), a centrally acting muscle relaxant with expectorant properties.
References D.G. Workmann et. al. Curr. Ther. Res. 41 1751 (1980).Formula:C10H12O5Color and Shape:NeatMolecular weight:212.2



