CAS 130570-45-5

1-Ethoxy-4-nitro-3-(2-nitroethenyl)-2-(phenylmethoxy)benzene

Description:

1-Ethoxy-4-nitro-3-(2-nitroethenyl)-2-(phenylmethoxy)benzene, with the CAS number 130570-45-5, is an organic compound characterized by its complex aromatic structure. This compound features a benzene ring substituted with various functional groups, including an ethoxy group, nitro groups, and a phenylmethoxy group. The presence of nitro groups indicates that it may exhibit significant electron-withdrawing properties, which can influence its reactivity and stability. The ethoxy group contributes to its solubility in organic solvents, while the phenylmethoxy moiety can enhance its hydrophobic characteristics. This compound may be of interest in synthetic organic chemistry and materials science due to its potential applications in dyes, pharmaceuticals, or as intermediates in chemical synthesis. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they are influenced by the molecular interactions and the overall structure of the compound. Safety data and handling precautions should also be considered due to the presence of nitro groups, which can be hazardous.

Formula: C₁₇H₁₆N₂O₆

InChI: InChI=1S/C17H16N2O6/c1-2-24-16-9-8-15(19(22)23)14(10-11-18(20)21)17(16)25-12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3

InChI key: InChIKey=JSKVEFJTWHCZCK-UHFFFAOYSA-N

SMILES: C(=CN(=O)=O)C1=C(OCC2=CC=CC=C2)C(OCC)=CC=C1N(=O)=O

Synonyms:

• 1-Ethoxy-4-nitro-3-(2-nitroethenyl)-2-(phenylmethoxy)benzene
• Benzene, 1-ethoxy-4-nitro-3-(2-nitroethenyl)-2-(phenylmethoxy)-

Benzene, 1-ethoxy-4-nitro-3-(2-nitroethenyl)-2-(phenylmethoxy)-

CAS: 130570-45-5

Formula: C₁₇H₁₆N₂O₆

Molecular weight: 344.3187

Ref: IN-DA000UMY