CymitQuimica logo

CAS 1305711-27-6

:

2-Methoxy-5-(1H-pyrazol-1-yl)-3-pyridinamine

Description:
2-Methoxy-5-(1H-pyrazol-1-yl)-3-pyridinamine is an organic compound characterized by its complex structure, which includes a pyridine ring, a methoxy group, and a pyrazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the methoxy group can influence its solubility and reactivity, while the pyrazole ring may impart specific pharmacological properties. As a pyridinamine, it may also participate in hydrogen bonding and coordination with metal ions, enhancing its utility in various chemical applications. The compound's molecular interactions can be significant in medicinal chemistry, particularly in the development of pharmaceuticals. Its CAS number, 1305711-27-6, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential uses in research and industry. Overall, 2-Methoxy-5-(1H-pyrazol-1-yl)-3-pyridinamine represents a versatile structure with implications in both synthetic and medicinal chemistry.
Formula:C9H10N4O
InChI:InChI=1S/C9H10N4O/c1-14-9-8(10)5-7(6-11-9)13-4-2-3-12-13/h2-6H,10H2,1H3
InChI key:InChIKey=YMPDFTJOBQPLHJ-UHFFFAOYSA-N
SMILES:NC1=CC(=CN=C1OC)N2C=CC=N2
Synonyms:
  • 2-Methoxy-5-(1H-pyrazol-1-yl)-3-pyridinamine
  • 3-Pyridinamine, 2-methoxy-5-(1H-pyrazol-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.