CAS 1305711-35-6

1-(2-Aminoethyl)-1H-indole-5-carboxamide

Description:

1-(2-Aminoethyl)-1H-indole-5-carboxamide, identified by its CAS number 1305711-35-6, is a chemical compound that features an indole ring, which is a bicyclic structure composed of a benzene fused to a pyrrole. This compound contains an aminoethyl side chain and a carboxamide functional group, contributing to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The indole moiety is known for its role in various biological processes and is a common scaffold in pharmaceuticals. This compound may exhibit properties such as being a potential ligand for biological targets, and its structure suggests it could be involved in interactions with neurotransmitter systems or other cellular pathways. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the purity and specific conditions under which it is studied. Overall, 1-(2-Aminoethyl)-1H-indole-5-carboxamide is of interest in medicinal chemistry and pharmacology.

Formula: C₁₁H₁₃N₃O

InChI: InChI=1S/C11H13N3O/c12-4-6-14-5-3-8-7-9(11(13)15)1-2-10(8)14/h1-3,5,7H,4,6,12H2,(H2,13,15)

InChI key: InChIKey=KBMBHUXLSJBOPE-UHFFFAOYSA-N

SMILES: C(CN)N1C=2C(=CC(C(N)=O)=CC2)C=C1

Synonyms:

• 1-(2-Aminoethyl)-1H-indole-5-carboxamide
• 1H-Indole-5-carboxamide, 1-(2-aminoethyl)-