CAS 1305711-91-4

Isoquinoline, 1,2,3,4-tetrahydro-4,4,7-trimethyl-, hydrochloride (1:1)

Description:

Isoquinoline, 1,2,3,4-tetrahydro-4,4,7-trimethyl-, hydrochloride (1:1) is a chemical compound characterized by its tetrahydroisoquinoline structure, which features a bicyclic framework consisting of a benzene ring fused to a piperidine-like ring. This compound is typically a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The presence of multiple methyl groups contributes to its hydrophobic characteristics, influencing its solubility and reactivity. Isoquinoline derivatives are often studied for their biological activities, including potential pharmacological effects. The hydrochloride form enhances stability and facilitates handling in laboratory settings. As with many isoquinoline derivatives, this compound may exhibit various properties such as fluorescence or specific reactivity with other chemical agents, making it of interest in medicinal chemistry and organic synthesis. Safety data should be consulted for handling and potential hazards associated with this compound.

Formula: C₁₂H₁₇N·ClH

InChI: InChI=1S/C12H17N.ClH/c1-9-4-5-11-10(6-9)7-13-8-12(11,2)3;/h4-6,13H,7-8H2,1-3H3;1H

InChI key: InChIKey=WUKIDKHWNXUNCL-UHFFFAOYSA-N

SMILES: CC1(C)C=2C(=CC(C)=CC2)CNC1.Cl

Synonyms:

• Isoquinoline, 1,2,3,4-tetrahydro-4,4,7-trimethyl-, hydrochloride (1:1)