CAS 1305711-92-5

3-Pyridinemethanamine, α-(4-fluorophenyl)-N-propyl-, hydrochloride (1:2)

Description:

3-Pyridinemethanamine, α-(4-fluorophenyl)-N-propyl-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and amine functional groups, which contribute to its potential biological activity. The presence of a 4-fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound's structure suggests it may exhibit properties relevant to medicinal chemistry, potentially acting as a ligand or modulator in various biological systems. Its specific interactions and efficacy would depend on its conformation and the presence of other functional groups. Safety and handling precautions should be observed, as with any chemical substance, particularly those with amine functionalities, which can be reactive. Further studies would be necessary to elucidate its pharmacological profile and potential therapeutic applications.

Formula: C₁₅H₁₇FN₂·2ClH

InChI: InChI=1S/C15H17FN2.2ClH/c1-2-9-18-15(13-4-3-10-17-11-13)12-5-7-14(16)8-6-12;;/h3-8,10-11,15,18H,2,9H2,1H3;2*1H

InChI key: InChIKey=IMNDJJIITFGEEU-UHFFFAOYSA-N

SMILES: C(NCCC)(C1=CC=C(F)C=C1)C=2C=CC=NC2.Cl

Synonyms:

• 3-Pyridinemethanamine, α-(4-fluorophenyl)-N-propyl-, hydrochloride (1:2)

[(4-Fluorophenyl)(pyridin-3-yl)methyl](propyl)amine dihydrochloride

CAS: 1305711-92-5

Versatile small molecule scaffold

Formula: C₁₅H₁₉Cl₂FN₂

Purity: Min. 95%

Molecular weight: 317.2 g/mol

Ref: 3D-FCC71192