CAS 1305712-06-4

Piperidine, 4-[4-(1-methylethyl)-4H-1,2,4-triazol-3-yl]-, hydrochloride (1:2)

Description:

Piperidine, 4-[4-(1-methylethyl)-4H-1,2,4-triazol-3-yl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The compound features a triazole moiety, specifically a 1,2,4-triazole, which is known for its biological activity and potential applications in pharmaceuticals. The presence of the isopropyl group (1-methylethyl) enhances its lipophilicity, potentially influencing its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for formulation in various applications. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific interactions and mechanisms of action would depend on the structural characteristics and functional groups present, which can influence its reactivity and biological profile. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₀H₁₈N₄·2ClH

InChI: InChI=1S/C10H18N4.2ClH/c1-8(2)14-7-12-13-10(14)9-3-5-11-6-4-9;;/h7-9,11H,3-6H2,1-2H3;2*1H

InChI key: InChIKey=VETFLMZSJIMTIU-UHFFFAOYSA-N

SMILES: C(C)(C)N1C(=NN=C1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-[4-(1-methylethyl)-4H-1,2,4-triazol-3-yl]-, hydrochloride (1:2)

4-[4-(Propan-2-yl)-4H-1,2,4-triazol-3-yl]piperidine dihydrochloride

CAS: 1305712-06-4

Versatile small molecule scaffold

Formula: C₁₀H₂₀Cl₂N₄

Purity: Min. 95%

Molecular weight: 267.2 g/mol

Ref: 3D-FCC71206