CAS 1305712-07-5

1,1-Dimethylethyl 4-[(2S)-2-amino-3-methyl-1-oxobutyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[(2S)-2-amino-3-methyl-1-oxobutyl]-1-piperazinecarboxylate, with the CAS number 1305712-07-5, is a chemical compound characterized by its complex structure, which includes a piperazine ring and an amino acid derivative. This compound typically exhibits properties associated with both amines and carboxylic acids, making it potentially useful in various biochemical applications. It may possess moderate solubility in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. The presence of the dimethyl group suggests steric hindrance, which could influence its reactivity and interaction with biological targets. Additionally, the amino acid moiety may impart specific biological activity, making it of interest in pharmaceutical research. Overall, this compound's unique structural features contribute to its potential utility in medicinal chemistry and related fields, although specific applications would depend on further empirical studies to elucidate its behavior in biological systems.

Formula: C₁₄H₂₇N₃O₃

InChI: InChI=1S/C14H27N3O3/c1-10(2)11(15)12(18)16-6-8-17(9-7-16)13(19)20-14(3,4)5/h10-11H,6-9,15H2,1-5H3/t11-/m0/s1

InChI key: InChIKey=HNTFIQHYJJSTQN-NSHDSACASA-N

SMILES: C([C@H](C(C)C)N)(=O)N1CCN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 1,1-Dimethylethyl 4-[(2S)-2-amino-3-methyl-1-oxobutyl]-1-piperazinecarboxylate
• 1-Piperazinecarboxylic acid, 4-[(2S)-2-amino-3-methyl-1-oxobutyl]-, 1,1-dimethylethyl ester