CymitQuimica logo

CAS 1305712-14-4

:

5-(1H-Imidazol-1-yl)-2-methoxy-3-pyridinamine

Description:
5-(1H-Imidazol-1-yl)-2-methoxy-3-pyridinamine, with the CAS number 1305712-14-4, is a chemical compound characterized by its unique structural features, which include an imidazole ring and a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic aromatic compounds, such as potential biological activity and solubility in polar solvents. The presence of the methoxy group enhances its lipophilicity, potentially influencing its interaction with biological targets. It may serve as a building block in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to engage in hydrogen bonding and π-π interactions. Additionally, the imidazole and pyridine rings can participate in various chemical reactions, making this compound versatile for synthetic applications. Its specific reactivity and biological activity would depend on the context of its use, including the presence of other functional groups and the overall molecular environment. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C9H10N4O
InChI:InChI=1S/C9H10N4O/c1-14-9-8(10)4-7(5-12-9)13-3-2-11-6-13/h2-6H,10H2,1H3
InChI key:InChIKey=VXLCYSZNKHLLRN-UHFFFAOYSA-N
SMILES:NC1=CC(=CN=C1OC)N2C=CN=C2
Synonyms:
  • 5-(1H-Imidazol-1-yl)-2-methoxy-3-pyridinamine
  • 3-Pyridinamine, 5-(1H-imidazol-1-yl)-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.