CAS 1305712-55-3

2-Furanpropanoic acid, β-amino-5-methyl-, hydrochloride (1:1), (βS)-

Description:

2-Furanpropanoic acid, β-amino-5-methyl-, hydrochloride (1:1), (βS)- is a chemical compound characterized by its furan ring structure, which contributes to its aromatic properties. This compound features a propanoic acid moiety, indicating the presence of a carboxylic acid functional group, which is known for its acidic properties. The β-amino group suggests that it contains an amine functional group attached to the β-carbon of the propanoic acid, which can influence its reactivity and biological activity. The presence of the methyl group at the 5-position of the furan ring can affect the compound's steric and electronic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential for biological applications. The (βS)- designation indicates the specific stereochemistry of the molecule, which can be crucial for its interaction with biological systems. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₈H₁₂ClNO₃

InChI: InChI=1S/C8H11NO3.ClH/c1-5-2-3-7(12-5)6(9)4-8(10)11;/h2-3,6H,4,9H2,1H3,(H,10,11);1H/t6-;/m0./s1

InChI key: InChIKey=RATOKKKOSPUUQN-RGMNGODLSA-N

SMILES: [C@@H](CC(O)=O)(N)C=1OC(C)=CC1.Cl

Synonyms:

• 2-Furanpropanoic acid, β-amino-5-methyl-, hydrochloride (1:1), (βS)-
• (S)-3-amino-3-(5-methylfuran-2-yl)propanoic acid hydrochloride
• (3S)-3-AMINO-3-(5-METHYLFURAN-2-YL)PROPANOIC ACID HYDROCHLORIDE