CAS 1305712-61-1
:4-Azido-4-(4-fluorophenyl)tetrahydro-2H-pyran
Description:
4-Azido-4-(4-fluorophenyl)tetrahydro-2H-pyran is a chemical compound characterized by its unique structural features, including a tetrahydropyran ring and an azido functional group. The presence of the azido group (-N3) imparts notable reactivity, making it a potential candidate for various synthetic applications, particularly in click chemistry and as a precursor for further functionalization. The fluorophenyl substituent enhances the compound's electronic properties, potentially influencing its reactivity and solubility. This compound may exhibit interesting biological activities due to its structural motifs, which can interact with biological targets. Additionally, the stability of the azido group under certain conditions allows for its use in photochemical reactions. As with many azido compounds, caution is advised due to the potential for explosive decomposition under specific conditions. Overall, 4-Azido-4-(4-fluorophenyl)tetrahydro-2H-pyran represents a versatile building block in organic synthesis and materials science.
Formula:C11H12FN3O
InChI:InChI=1S/C11H12FN3O/c12-10-3-1-9(2-4-10)11(14-15-13)5-7-16-8-6-11/h1-4H,5-8H2
InChI key:InChIKey=PKFMWERNGBFMKQ-UHFFFAOYSA-N
SMILES:N(=[N+]=[N-])C1(CCOCC1)C2=CC=C(F)C=C2
Synonyms:- 4-Azido-4-(4-fluorophenyl)tetrahydro-2H-pyran
- 2H-Pyran, 4-azido-4-(4-fluorophenyl)tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Azido-4-(4-fluorophenyl)oxane
CAS:Controlled ProductFormula:C11H12FN3OColor and Shape:NeatMolecular weight:221.231
