CAS 1305712-63-3

Piperidine, 3-(4-cyclopropyl-4H-1,2,4-triazol-3-yl)-, hydrochloride (1:2)

Description:

Piperidine, 3-(4-cyclopropyl-4H-1,2,4-triazol-3-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the 4-cyclopropyl-4H-1,2,4-triazole moiety introduces additional nitrogen atoms and contributes to the compound's potential biological activity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacokinetic properties. The triazole ring is known for its role in various pharmaceutical applications, including antifungal and antimicrobial activities. The cyclopropyl group can also impart unique steric and electronic properties, potentially affecting the compound's interaction with biological targets. Overall, this substance may be of interest in medicinal chemistry and drug development, particularly in the context of exploring new therapeutic agents. However, specific biological activities, safety profiles, and regulatory status would require further investigation and validation through experimental studies.

Formula: C₁₀H₁₆N₄·2ClH

InChI: InChI=1S/C10H16N4.2ClH/c1-2-8(6-11-5-1)10-13-12-7-14(10)9-3-4-9;;/h7-9,11H,1-6H2;2*1H

InChI key: InChIKey=ZBXXMJLLLBFVNG-UHFFFAOYSA-N

SMILES: N1(C(=NN=C1)C2CCCNC2)C3CC3.Cl

Synonyms:

• Piperidine, 3-(4-cyclopropyl-4H-1,2,4-triazol-3-yl)-, hydrochloride (1:2)

3-(4-Cyclopropyl-4H-1,2,4-triazol-3-yl)piperidine dihydrochloride

CAS: 1305712-63-3

Versatile small molecule scaffold

Formula: C₁₀H₁₈Cl₂N₄

Purity: Min. 95%

Molecular weight: 265.18 g/mol

Ref: 3D-FCC71263