CAS 1305712-70-2

2,2,2-Trifluoroethyl N-2-thienylcarbamate

Description:

2,2,2-Trifluoroethyl N-2-thienylcarbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a thienyl moiety linked through a carbamate functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. It exhibits properties common to carbamates, such as being a potential inhibitor of certain enzymes, which can make it relevant in agricultural applications as a pesticide or herbicide. The presence of trifluoroethyl groups often enhances lipophilicity and stability, potentially affecting its bioactivity and environmental persistence. Additionally, the thienyl group may contribute to its reactivity and interaction with biological systems. Safety data should be consulted, as compounds with fluorinated groups can exhibit unique toxicological profiles. Overall, 2,2,2-Trifluoroethyl N-2-thienylcarbamate represents a specialized compound with applications in chemistry and possibly in agrochemical formulations.

Formula: C₇H₆F₃NO₂S

InChI: InChI=1S/C7H6F3NO2S/c8-7(9,10)4-13-6(12)11-5-2-1-3-14-5/h1-3H,4H2,(H,11,12)

InChI key: InChIKey=KHZDHCVOPQWNOV-UHFFFAOYSA-N

SMILES: N(C(OCC(F)(F)F)=O)C1=CC=CS1

Synonyms:

• Carbamic acid, N-2-thienyl-, 2,2,2-trifluoroethyl ester
• 2,2,2-Trifluoroethyl N-2-thienylcarbamate

2,2,2-Trifluoroethyl N-(thiophen-2-yl)carbamate

CAS: 1305712-70-2

Versatile small molecule scaffold

Formula: C₇H₆F₃NO₂S

Purity: Min. 95%

Molecular weight: 225.19 g/mol

Ref: 3D-FCC71270