CymitQuimica logo

CAS 13058-05-4

:

2-Chloro-1,3,4,5,6-pentamethylborazine

Description:
2-Chloro-1,3,4,5,6-pentamethylborazine is an organoboron compound characterized by its unique borazine structure, which is a six-membered ring containing alternating boron and nitrogen atoms. The presence of five methyl groups and one chlorine substituent contributes to its chemical properties, making it a derivative of borazine with enhanced steric and electronic characteristics. This compound is typically colorless to pale yellow and exhibits a relatively low melting point. It is soluble in organic solvents, which is indicative of its non-polar nature due to the presence of the methyl groups. The chlorine atom introduces reactivity, allowing for potential substitution reactions. 2-Chloro-1,3,4,5,6-pentamethylborazine can be utilized in various applications, including as a precursor in the synthesis of other boron-containing compounds and in materials science due to its unique properties. Its stability and reactivity make it of interest in both academic research and industrial applications, particularly in the development of new materials and chemical processes.
Formula:C5H15B3ClN3
InChI:InChI=1S/C5H15B3ClN3/c1-6-10(3)7(2)12(5)8(9)11(6)4/h1-5H3
InChI key:InChIKey=GMHZZSZSPYDVPS-UHFFFAOYSA-N
SMILES:CB1N(C)B(C)N(C)B(Cl)N1C
Synonyms:
  • Borazine, 2-chloro-1,3,4,5,6-pentamethyl-
  • 2-Chloro-1,3,4,5,6-pentamethylborazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.