CAS 13059-63-7

L-Cystine, radical ion(1+), dihydrochloride

Description:

L-Cystine, radical ion (1+), dihydrochloride is a derivative of the amino acid cysteine, characterized by the presence of a disulfide bond between two cysteine molecules. This compound typically exists as a dication due to the protonation of its amino groups, and the dihydrochloride form indicates the presence of two hydrochloride ions associated with the molecule. L-Cystine plays a crucial role in protein structure and function, particularly in the formation of disulfide bridges that stabilize protein conformation. The radical ion designation suggests that it may have unpaired electrons, which can impart unique reactivity and properties, making it of interest in various biochemical and pharmacological contexts. It is soluble in water, and its stability can be influenced by pH and temperature. As a compound, L-Cystine is involved in redox reactions and may have implications in oxidative stress and cellular signaling pathways. Its CAS number, 13059-63-7, is a unique identifier that facilitates its identification in chemical databases and literature.

Formula: C₆H₁₂N₂O₄S₂·2ClH

InChI: InChI=1S/C6H12N2O4S2.2ClH/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;;/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);2*1H

InChI key: InChIKey=HHGZUQPEIHGQST-UHFFFAOYSA-N

SMILES: C(CSSCC(C(O)=O)N)(C(O)=O)N.Cl

Synonyms:

• L-Cystine, radical ion(1+), dihydrochloride

2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid dihydrochloride

CAS: 13059-63-7

Formula: C₆H₁₄Cl₂N₂O₄S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 313.2224

Ref: IN-DA000UOT

L-Cystine dihydrochloride

CAS: 13059-63-7

L-Cystine dihydrochloride is a white crystalline powder that is used to treat acute radiation syndrome. It is an amino acid that contains two cysteine residues linked by a disulfide bond. Cysteine is necessary for the formation of proteins and peptides, which are important in antibody production. L-Cystine dihydrochloride has been shown to increase the uptake of radioactive substances in cells. This drug also increases the amount of bioactive molecules such as glutathione, which protects cells from oxidative damage caused by radiation. The effects of L-cystine dihydrochloride are dose dependent, with higher doses leading to greater cellular death.
The unpaired cysteines in L-cystine dihydrochloride can react with each other, forming a new molecule called S-thiolactone. This reaction is catalyzed by porcine pancreatic lipase (PPLL), a membrane protein found in pancreat

Formula: C₆H₁₄Cl₂N₂O₄S₂

Purity: Min. 95%

Molecular weight: 313.2 g/mol

Ref: 3D-NAA05963