CymitQuimica logo

CAS 130593-26-9

:

4-Thiazolecarboxylic acid, 4,5-dihydro-2-(6-hydroxy-4-methyl-2-benzothiazolyl)-, (S)-

Description:
4-Thiazolecarboxylic acid, 4,5-dihydro-2-(6-hydroxy-4-methyl-2-benzothiazolyl)-, (S)-, identified by CAS number 130593-26-9, is a chemical compound characterized by its thiazole and benzothiazole moieties, which contribute to its biological activity and potential applications in pharmaceuticals. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, and a carboxylic acid functional group that enhances its solubility and reactivity. The presence of a hydroxyl group and a methyl group on the benzothiazole structure suggests potential for hydrogen bonding and hydrophobic interactions, respectively. The (S)- designation indicates that the compound has a specific stereochemistry, which can influence its biological interactions and efficacy. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its unique structural features allow for potential applications in treating diseases or conditions where thiazole and benzothiazole derivatives have shown promise.
Formula:C12H10N2O3S2
InChI:InChI=1S/C12H10N2O3S2/c1-5-2-6(15)3-8-9(5)14-11(19-8)10-13-7(4-18-10)12(16)17/h2-3,7,15H,4H2,1H3,(H,16,17)/t7-/m1/s1
InChI key:InChIKey=NIYJAWAPTYCFGV-SSDOTTSWSA-N
SMILES:CC1=C2C(SC(=N2)C3=N[C@@H](C(O)=O)CS3)=CC(O)=C1
Synonyms:
  • 4-Thiazolecarboxylic acid, 4,5-dihydro-2-(6-hydroxy-4-methyl-2-benzothiazolyl)-, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.