
CAS 130597-56-7
:4-(Chloromethyl)-N-methyl-2-nitrobenzenamine
Description:
4-(Chloromethyl)-N-methyl-2-nitrobenzenamine, with the CAS number 130597-56-7, is an organic compound characterized by its aromatic structure, which includes a nitro group and a chloromethyl substituent. This compound features a benzene ring with a nitro group (-NO2) positioned at the 2-position and a chloromethyl group (-CH2Cl) at the 4-position, along with a methylamino group (-N(CH3)2) at the nitrogen atom. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis and pharmaceuticals. The chloromethyl group can participate in nucleophilic substitution reactions, while the nitro group can serve as a site for further chemical modifications. This compound is typically handled with caution due to its potential toxicity and the presence of reactive functional groups. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, 4-(Chloromethyl)-N-methyl-2-nitrobenzenamine is a versatile intermediate in chemical synthesis.
Formula:C8H9ClN2O2
InChI:InChI=1S/C8H9ClN2O2/c1-10-7-3-2-6(5-9)4-8(7)11(12)13/h2-4,10H,5H2,1H3
InChI key:InChIKey=VYTKQQBCZAWJMA-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(NC)C=CC(CCl)=C1
Synonyms:- Benzenamine, 4-(chloromethyl)-N-methyl-2-nitro-
- 4-(Chloromethyl)-N-methyl-2-nitrobenzenamine
- 4-Methylamino-3-nitrobenzylchloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
