CymitQuimica logo

CAS 130598-72-0

:

6-Phenyl-1H-imidazo(1,2-b)pyrazole

Description:
6-Phenyl-1H-imidazo(1,2-b)pyrazole is a heterocyclic compound characterized by its fused imidazole and pyrazole rings, which contribute to its unique chemical properties. This compound typically exhibits a molecular structure that includes a phenyl group attached to the imidazole ring, enhancing its potential for various biological activities. It is often recognized for its role in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of nitrogen atoms in the ring structure can influence its reactivity and solubility, making it a subject of interest in drug design. Additionally, 6-Phenyl-1H-imidazo(1,2-b)pyrazole may exhibit fluorescence properties, which can be advantageous in analytical applications. Its synthesis often involves multi-step organic reactions, and it may be evaluated for its efficacy in various therapeutic areas, including anti-inflammatory and anticancer activities. As with many heterocycles, the compound's stability and reactivity can be influenced by substituents on the rings, making it a versatile scaffold in organic synthesis.
Formula:C11H9N3
InChI:InChI=1/C11H9N3/c1-2-4-9(5-3-1)10-8-11-12-6-7-14(11)13-10/h1-8,13H
SMILES:c1ccc(cc1)c1cc2nccn2[nH]1
Synonyms:
  • 1H-Imidazo(1,2-b)pyrazole, 6-phenyl-
  • 6-phenyl-5H-imidazo[1,2-b]pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.