CymitQuimica logo

CAS 130598-73-1

:

6-(4-Fluorophenyl)-1H-imidazo(1,2-b)pyrazole

Description:
6-(4-Fluorophenyl)-1H-imidazo(1,2-b)pyrazole is a heterocyclic compound characterized by its imidazo and pyrazole ring systems, which contribute to its unique chemical properties. The presence of a fluorophenyl group enhances its lipophilicity and may influence its biological activity. This compound typically exhibits a molecular structure that includes nitrogen atoms within the rings, which can participate in hydrogen bonding and coordination with metal ions. It is often studied for its potential pharmacological applications, particularly in the fields of medicinal chemistry and drug development, due to its ability to interact with various biological targets. The compound's stability, solubility, and reactivity can vary based on the functional groups attached to the core structure. Additionally, its synthesis may involve multi-step organic reactions, and it can be characterized using techniques such as NMR spectroscopy, mass spectrometry, and crystallography. Overall, 6-(4-Fluorophenyl)-1H-imidazo(1,2-b)pyrazole represents a significant class of compounds with potential therapeutic implications.
Formula:C11H8FN3
InChI:InChI=1S/C11H8FN3/c12-9-3-1-8(2-4-9)10-7-11-13-5-6-15(11)14-10/h1-7,13H
InChI key:InChIKey=TWXLPMFPJGQJCA-UHFFFAOYSA-N
SMILES:FC1=CC=C(C=2C=C3N(N2)C=CN3)C=C1
Synonyms:
  • 1H-Imidazo(1,2-b)pyrazole, 6-(4-fluorophenyl)-
  • 6-(4-fluorophenyl)-5H-imidazo[1,2-b]pyrazole
  • 6-(4-Fluorophenyl)-1H-imidazo[1,2-b]pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.