CAS 130599-34-7

5-(4-TRIFLUOROMETHYL-PHENYL)-2H-PYRAZOL-3-YLAMINE

Description:

5-(4-Trifluoromethyl-phenyl)-2H-pyrazol-3-ylamine is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) on the phenyl ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. This compound is typically used in pharmaceutical research and development due to its potential as a building block for various bioactive molecules. Its amine functional group (-NH2) can participate in hydrogen bonding and nucleophilic reactions, making it versatile in synthetic chemistry. The trifluoromethyl group is known for imparting unique electronic properties, which can enhance the compound's stability and influence its interaction with biological targets. Overall, 5-(4-trifluoromethyl-phenyl)-2H-pyrazol-3-ylamine is notable for its structural features that contribute to its utility in medicinal chemistry and material science.

Formula: C₁₀H₈F₃N₃

InChI: InChI=1S/C10H8F3N3/c11-10(12,13)7-3-1-6(2-4-7)8-5-9(14)16-15-8/h1-5H,(H3,14,15,16)

SMILES: c1cc(ccc1c1cc(=N)[nH][nH]1)C(F)(F)F

Synonyms:

• 5-[4-(trifluoromethyl)phenyl]-1H-Pyrazol-3-amine

3-(4-(Trifluoromethyl)phenyl)-1H-pyrazol-5-amine

CAS: 130599-34-7

Formula: C₁₀H₈F₃N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 227.1858

Ref: IN-DA0080M8

3-[4-(Trifluoromethyl)phenyl]-1H-pyrazol-5-amine

CAS: 130599-34-7

3-[4-(Trifluoromethyl)phenyl]-1H-pyrazol-5-amine

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 227.19g/mol

Ref: 54-PC200599

3-(4-(Trifluoromethyl)phenyl)-1H-pyrazol-5-amine

CAS: 130599-34-7

Formula: C₁₀H₈F₃N₃

Purity: 95.0%

Color and Shape: Solid, Needles

Molecular weight: 227.19

Ref: 10-F225666