CymitQuimica logo

CAS 13061-97-7

:

Borinic acid, dimethyl-

Description:
Borinic acid, dimethyl- (CAS 13061-97-7) is an organoboron compound characterized by the presence of a boron atom bonded to two methyl groups and a hydroxyl group, giving it the general formula B(OH)(CH3)2. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. Dimethyl borinic acid is known for its reactivity, particularly in forming complexes with various nucleophiles due to the electrophilic nature of the boron atom. It can participate in various chemical reactions, including those involving nucleophilic attack, making it useful in organic synthesis and materials science. Additionally, it can serve as a precursor for the preparation of boron-containing compounds and catalysts. The compound is also of interest in the field of medicinal chemistry and materials development due to its unique properties. However, handling should be done with care, as organoboron compounds can be sensitive to moisture and air, potentially leading to hydrolysis or oxidation.
Formula:C2H7BO
InChI:InChI=1S/C2H7BO/c1-3(2)4/h4H,1-2H3
InChI key:InChIKey=HWEKVSRZLQDNFL-UHFFFAOYSA-N
SMILES:B(C)(C)O
Synonyms:
  • Hydroxydimethylborane
  • Borinic acid, dimethyl-
  • Dimethylborinic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.