CAS 130612-84-9: FLUORO(PHENYLTHIO)ACETONITRILE

Description:Fluoro(phenylthio)acetonitrile, with the CAS number 130612-84-9, is an organic compound characterized by the presence of a fluorine atom, a phenylthio group, and a nitrile functional group. This compound typically exhibits a polar nature due to the presence of the nitrile group, which can engage in hydrogen bonding and dipole interactions. The fluorine atom contributes to its reactivity and can influence the electronic properties of the molecule, potentially enhancing its electrophilic character. The phenylthio moiety introduces aromatic characteristics, which can affect the compound's stability and solubility in various solvents. Fluoro(phenylthio)acetonitrile may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, owing to its unique structural features. Its properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the overall structure. Safety data should be consulted for handling and storage, as compounds containing fluorine and nitrile groups can pose health and environmental risks.

Formula:C₈H₆FNS

InChI:InChI=1/C8H6FNS/c9-8(6-10)11-7-4-2-1-3-5-7/h1-5,8H

Synonyms:
Acetonitrile, 2-Fluoro-2-(Phenylthio)-
Fluoro(phenylsulfanyl)acetonitrile
2-Fluoro-2-Phenylsulfanyl-Acetonitrile

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Fluoro(phenylthio)acetonitrile REF: 3B-F0464CAS: 130612-84-9	>97.0%(GC)	122.00 €	Thu 13 Mar 25
Acetonitrile, 2-fluoro-2-(phenylthio)- REF: IN-DA000UP5CAS: 130612-84-9	97%	65.00 €~217.00 €	Thu 20 Mar 25
2-Fluoro-2-(phenylthio)acetonitrile REF: 10-F725429CAS: 130612-84-9	95+%	To inquire	Tue 01 Apr 25
Fluoro(Phenylsulfanyl)Acetonitrile REF: 3D-FF81709CAS: 130612-84-9	Min. 95%	- - -	Discontinued product