CAS 130612-84-9: FLUORO(PHENYLTHIO)ACETONITRILE
Description:Fluoro(phenylthio)acetonitrile, with the CAS number 130612-84-9, is an organic compound characterized by the presence of a fluorine atom, a phenylthio group, and a nitrile functional group. This compound typically exhibits a polar nature due to the presence of the nitrile group, which can engage in hydrogen bonding and dipole interactions. The fluorine atom contributes to its reactivity and can influence the electronic properties of the molecule, potentially enhancing its electrophilic character. The phenylthio moiety introduces aromatic characteristics, which can affect the compound's stability and solubility in various solvents. Fluoro(phenylthio)acetonitrile may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, owing to its unique structural features. Its properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the overall structure. Safety data should be consulted for handling and storage, as compounds containing fluorine and nitrile groups can pose health and environmental risks.
Formula:C8H6FNS
InChI:InChI=1/C8H6FNS/c9-8(6-10)11-7-4-2-1-3-5-7/h1-5,8H
- Synonyms:
- Acetonitrile, 2-Fluoro-2-(Phenylthio)-
- Fluoro(phenylsulfanyl)acetonitrile
- 2-Fluoro-2-Phenylsulfanyl-Acetonitrile
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Fluoro(phenylthio)acetonitrile REF: 3B-F0464CAS: 130612-84-9 | >97.0%(GC) | 122.00 € | Tue 29 Apr 25 |
![]() | Acetonitrile, 2-fluoro-2-(phenylthio)- REF: IN-DA000UP5CAS: 130612-84-9 | 97% | 65.00 €~207.00 € | Tue 06 May 25 |
![]() | 2-Fluoro-2-(phenylthio)acetonitrile REF: 10-F725429CAS: 130612-84-9 | 95+% | To inquire | Wed 14 May 25 |
![]() | Fluoro(Phenylsulfanyl)Acetonitrile REF: 3D-FF81709CAS: 130612-84-9 | Min. 95% | - - - | Discontinued product |

Fluoro(phenylthio)acetonitrile
Ref: 3B-F0464
100mg | 122.00 € |

Acetonitrile, 2-fluoro-2-(phenylthio)-
Ref: IN-DA000UP5
10mg | 65.00 € |

Ref: 10-F725429
25mg | To inquire | ||
100mg | To inquire |

Fluoro(Phenylsulfanyl)Acetonitrile
Ref: 3D-FF81709
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |