CymitQuimica logo

CAS 13062-93-6

:

2-(4-methoxyphenyl)propan-1-amine hydrochloride (1:1)

Description:
2-(4-Methoxyphenyl)propan-1-amine hydrochloride, with the CAS number 13062-93-6, is a chemical compound characterized by its amine functional group and a methoxy-substituted phenyl ring. This substance typically appears as a white to off-white crystalline powder and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The compound is often studied for its potential pharmacological properties, particularly in the context of its structural similarity to other psychoactive substances. Its molecular structure includes a propan-1-amine backbone, which contributes to its basicity and reactivity. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. Safety and handling precautions are essential, as with any chemical substance, to mitigate risks associated with exposure or ingestion. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry research.
Formula:C10H16ClNO
InChI:InChI=1/C10H15NO.ClH/c1-8(7-11)9-3-5-10(12-2)6-4-9;/h3-6,8H,7,11H2,1-2H3;1H
SMILES:CC(CN)c1ccc(cc1)OC.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.