CAS 130624-89-4
:(R)-2-(tert-Butoxycarbonylamino)-2-((1R,4R)-4-hydroxycyclohexyl)acetic acid
Description:
(R)-2-(tert-Butoxycarbonylamino)-2-((1R,4R)-4-hydroxycyclohexyl)acetic acid, with CAS number 130624-89-4, is an amino acid derivative characterized by its chiral centers, which contribute to its stereochemistry and potential biological activity. This compound features a tert-butoxycarbonyl (Boc) protecting group, commonly used in peptide synthesis to protect amine functionalities. The presence of a hydroxycyclohexyl group indicates a cyclic structure that may influence the compound's conformational flexibility and interactions with biological targets. The carboxylic acid functional group is crucial for its acidity and reactivity, allowing for potential participation in various chemical reactions, including esterification and amidation. This compound may exhibit specific pharmacological properties due to its structural features, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature, which are important considerations in both laboratory and therapeutic contexts.
Formula:C13H23NO5
InChI:InChI=1/C13H23NO5/c1-13(2,3)19-12(18)14-10(11(16)17)8-4-6-9(15)7-5-8/h8-10,15H,4-7H2,1-3H3,(H,14,18)(H,16,17)/t8-,9-,10?
SMILES:CC(C)(C)OC(=NC([C@H]1CC[C@@H](CC1)O)C(=O)O)O
Synonyms:- 2-(Tert-Butoxycarbonylamino)-2-(4-Hydroxycyclohexyl)Acetic Acid
- Cyclohexaneacetic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-4-hydroxy-, [1(R)-cis]- (9CI)
- (R)-2-(TERT-BUTOXYCARBONYLAMINO)-2-((1R,4R)-4-HYDROXYCYCLOHEXYL)ACETIC ACID
- 2-(4-hydroxycyclohexyl)-2-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-2-((tert-Butoxycarbonyl)amino)-2-((1r,4R)-4-hydroxycyclohexyl)acetic acid
CAS:Formula:C13H23NO5Molecular weight:273.3254
