CAS 130627-10-0
:2-AMINO-BENZOIC ACID 2-OXO-2-PHENYL-ETHYL ESTER
Description:
2-Amino-benzoic acid 2-oxo-2-phenyl-ethyl ester, also known as a derivative of amino benzoic acid, is an organic compound characterized by the presence of both an amino group and a carboxylic acid group, which are typical functional groups in amino acids. The esterification of the carboxylic acid with a phenyl-ethyl moiety contributes to its unique properties, including potential lipophilicity and reactivity. This compound may exhibit biological activity due to the amino group, which can participate in hydrogen bonding and interact with biological targets. It is likely to be soluble in organic solvents and may have limited solubility in water, depending on the specific structure and substituents. The presence of the phenyl group can enhance its stability and influence its electronic properties. As with many organic compounds, its reactivity can be influenced by environmental factors such as pH and temperature. Applications may include use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific uses would depend on further research and development.
Formula:C15H13NO3
InChI:InChI=1/C15H13NO3/c16-13-9-5-4-8-12(13)15(18)19-10-14(17)11-6-2-1-3-7-11/h1-9H,10,16H2
SMILES:c1ccc(cc1)C(=O)COC(=O)c1ccccc1N
Synonyms:- 2-Oxo-2-Phenylethyl 2-Aminobenzenecarboxylate
- 2-Oxo-2-Phenylethyl 2-Aminobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
