CAS 13063-01-9
:2-(2,5-dimethoxyphenyl)-N-methylethanamine hydrochloride (1:1)
Description:
2-(2,5-Dimethoxyphenyl)-N-methylethanamine hydrochloride, with the CAS number 13063-01-9, is a chemical compound that belongs to the class of substituted phenethylamines. It features a dimethoxy-substituted phenyl ring, which contributes to its unique electronic properties and potential biological activity. The presence of the N-methyl group and the ethylamine chain suggests that it may interact with neurotransmitter systems, potentially influencing mood or perception. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including research and potential therapeutic contexts. The compound's structure indicates that it may exhibit properties similar to other psychoactive substances, although specific pharmacological effects would depend on its interaction with biological targets. Safety and handling precautions are essential, as with any chemical, due to potential toxicity or regulatory considerations. Further studies would be necessary to fully elucidate its characteristics, including its stability, reactivity, and biological effects.
Formula:C11H18ClNO2
InChI:InChI=1/C11H17NO2.ClH/c1-12-7-6-9-8-10(13-2)4-5-11(9)14-3;/h4-5,8,12H,6-7H2,1-3H3;1H
Synonyms:- benzeneethanamine, 2,5-dimethoxy-N-methyl-, hydrochloride (1:1)
- 2-(2,5-Dimethoxyphenyl)-N-methylethanamine hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.