CymitQuimica logo

CAS 1306310-33-7

:

α-(Trifluoromethyl)-2-pyrrolidinemethanol

Description:
α-(Trifluoromethyl)-2-pyrrolidinemethanol is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a trifluoromethyl group. This compound typically exhibits properties associated with both amines and alcohols due to the presence of the hydroxyl (-OH) group and the nitrogen atom in the pyrrolidine ring. The trifluoromethyl group contributes to its lipophilicity and can influence its reactivity and interaction with biological systems. It may exhibit moderate to high polarity, affecting its solubility in various solvents. The presence of the trifluoromethyl group can also enhance the compound's stability and resistance to metabolic degradation, making it of interest in medicinal chemistry and drug design. Additionally, the compound's potential applications may include use as a building block in organic synthesis or as a ligand in coordination chemistry. Overall, the unique combination of functional groups in α-(Trifluoromethyl)-2-pyrrolidinemethanol makes it a compound of interest in various fields of chemical research.
Formula:C6H10F3NO
InChI:InChI=1S/C6H10F3NO/c7-6(8,9)5(11)4-2-1-3-10-4/h4-5,10-11H,1-3H2
InChI key:InChIKey=FRCMYJLVRLEIBR-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(O)C1CCCN1
Synonyms:
  • 2-Pyrrolidinemethanol, α-(trifluoromethyl)-
  • α-(Trifluoromethyl)-2-pyrrolidinemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.