CAS 130634-09-2

N-(2-Hydroxyethyl)-3-(4-nitrophenyl)propylamine

Description:

N-(2-Hydroxyethyl)-3-(4-nitrophenyl)propylamine, identified by its CAS number 130634-09-2, is an organic compound characterized by the presence of both amine and hydroxyl functional groups, which contribute to its reactivity and solubility properties. This compound features a propylamine backbone substituted with a 4-nitrophenyl group, which imparts distinct electronic properties due to the nitro group’s electron-withdrawing nature. The hydroxyl group enhances its hydrophilicity, making it more soluble in polar solvents. Typically, compounds of this nature are utilized in various applications, including pharmaceuticals and as intermediates in organic synthesis. The presence of the nitrophenyl moiety may also suggest potential uses in dye chemistry or as a precursor for further chemical modifications. Additionally, the compound's structure allows for potential interactions with biological systems, which could be explored in medicinal chemistry contexts. Overall, N-(2-Hydroxyethyl)-3-(4-nitrophenyl)propylamine exhibits a combination of functional groups that make it a versatile compound in chemical research and applications.

Formula: C₁₁H₁₆N₂O₃

InChI: InChI=1/C11H16N2O3/c14-9-8-12-7-1-2-10-3-5-11(6-4-10)13(15)16/h3-6,12,14H,1-2,7-9H2

SMILES: C(Cc1ccc(cc1)N(=O)=O)CNCCO

Synonyms:

• 2-[3-(4-Nitrophenyl)Propylamino]Ethanol
• N-(2-Hydroxyethyl)-N-[3-(4-Nitrophenyl)Propyl]Amine
• N-(2-Hydroxyethyl)-3-(4-Nitrophenyl) Propylamine C11H16N2O3
• N-(2-Hydroxyethyl)-3-(4-nitrophenyl) propylamine ,98%
• 2-{[3-(4-Nitrophenyl)Propyl]Amino}Ethanol

Ethanol, 2-[[3-(4-nitrophenyl)propyl]amino]-

CAS: 130634-09-2

Formula: C₁₁H₁₆N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 224.2563

Ref: IN-DA000UPN

2-((3-(4-Nitrophenyl)propyl)amino)ethanol

CAS: 130634-09-2

2-((3-(4-Nitrophenyl)propyl)amino)ethanol

Purity: 95%

Molecular weight: 224.26g/mol

Ref: 54-OR1052638