
CAS 130643-28-6
:1H-Pyrimido[5,4-c]azepine
Description:
1H-Pyrimido[5,4-c]azepine is a heterocyclic organic compound characterized by its fused ring structure, which incorporates both a pyrimidine and an azepine moiety. This compound typically exhibits a bicyclic framework, consisting of a six-membered azepine ring fused to a five-membered pyrimidine ring. The presence of nitrogen atoms in both rings contributes to its unique chemical properties, including potential basicity and reactivity. 1H-Pyrimido[5,4-c]azepine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features can influence its solubility, stability, and interaction with biological targets. The compound is often studied for its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Additionally, its synthesis and characterization are important for understanding its reactivity and potential applications in various chemical contexts. As with many heterocycles, the specific substituents and functional groups attached to the core structure can significantly affect its properties and reactivity.
Formula:C8H7N3
InChI:InChI=1S/C8H7N3/c1-2-8-7(4-9-3-1)5-10-6-11-8/h1-6H,(H,10,11)
InChI key:InChIKey=KHIKSHRMLZIZMK-UHFFFAOYSA-N
SMILES:C=12C(NC=NC1)=CC=CN=C2
Synonyms:- 1H-Pyrimido[5,4-c]azepine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
