CAS 13065-86-6

4-Amino-3-hydroxy-2-naphthalenecarboxylic acid

Description:

4-Amino-3-hydroxy-2-naphthalenecarboxylic acid, also known as 4-Amino-3-hydroxy-2-naphthoic acid, is an organic compound characterized by its naphthalene structure, which features both amino and hydroxyl functional groups. This compound typically appears as a solid, often in crystalline form, and is soluble in polar solvents such as water and alcohols due to the presence of its hydroxyl and carboxylic acid groups. It exhibits properties typical of aromatic compounds, including stability and the ability to participate in electrophilic substitution reactions. The amino group can act as a weak base, while the carboxylic acid group can donate protons, making it amphoteric. This compound is of interest in various fields, including pharmaceuticals and dye chemistry, due to its potential biological activity and utility as an intermediate in synthetic pathways. Its CAS number, 13065-86-6, is a unique identifier that facilitates its identification in chemical databases and regulatory frameworks.

Formula: C₁₁H₉NO₃

InChI: InChI=1S/C11H9NO3/c12-9-7-4-2-1-3-6(7)5-8(10(9)13)11(14)15/h1-5,13H,12H2,(H,14,15)

InChI key: InChIKey=VCJJAJXTFPNHON-UHFFFAOYSA-N

SMILES: NC=1C2=C(C=C(C(O)=O)C1O)C=CC=C2

Synonyms:

• 2-Naphthalenecarboxylic acid, 4-amino-3-hydroxy-
• 2-Naphthoic acid, 4-amino-3-hydroxy-
• 4-Amino-3-hydroxy-2-naphthalenecarboxylic acid