CymitQuimica logo

CAS 130650-09-8

:

3,4-Dihydro-6-[(Tert-Butyl)Dimethyl Silyloxy]-2H-Pyran

Description:
3,4-Dihydro-6-[(Tert-Butyl)Dimethyl Silyloxy]-2H-Pyran, with CAS number 130650-09-8, is an organic compound characterized by its unique structural features, including a pyran ring and a tert-butyl dimethylsilyloxy group. This compound typically exhibits properties associated with both siloxane and pyran derivatives, such as moderate polarity and potential hydrophobic characteristics due to the presence of the bulky tert-butyl group. The silyloxy functional group can enhance the compound's stability and reactivity, making it useful in various synthetic applications, particularly in organic synthesis and as a protecting group in chemical reactions. Additionally, the presence of the dihydro-pyran structure suggests potential applications in medicinal chemistry, as pyran derivatives are often explored for their biological activities. The compound's solubility and reactivity can vary depending on the solvent and conditions used, which is crucial for its application in laboratory settings. Overall, 3,4-Dihydro-6-[(Tert-Butyl)Dimethyl Silyloxy]-2H-Pyran represents a versatile building block in organic chemistry.
Formula:C11H22O2Si
InChI:InChI=1/C11H22O2Si/c1-11(2,3)14(4,5)13-10-8-6-7-9-12-10/h8H,6-7,9H2,1-5H3
SMILES:CC(C)(C)[Si](C)(C)OC1=CCCCO1
Synonyms:
  • 6-(Tert-Butyldimethylsilyloxy)-3,4-Dihydro-2 H-Pyran
  • 6-(Tert-Butyldimethylsilyloxy)-3,4- Dihydro-2H-Pyrane
  • 6-(T-Butyldimethylsiloxy)-3,4-Dihydro-2H-Pyran
  • tert-butyl(3,4-dihydro-2H-pyran-6-yloxy)dimethylsilane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.