
CAS 13066-96-1
:2,4-Diamino-1,3-benzenediol
Description:
2,4-Diamino-1,3-benzenediol, also known as 2,4-diaminophenol, is an organic compound characterized by its aromatic structure featuring two amino groups and a hydroxyl group attached to a benzene ring. This compound is typically a solid at room temperature and is soluble in water due to the presence of the hydroxyl group, which enhances its polarity. It exhibits properties typical of amines and phenols, such as the ability to participate in hydrogen bonding and act as a reducing agent. The presence of amino groups makes it a potential candidate for various applications, including dye manufacturing, pharmaceuticals, and as an intermediate in organic synthesis. Additionally, it can undergo various chemical reactions, such as acetylation and nitration, allowing for further functionalization. Safety considerations are important, as it may pose health risks if inhaled or ingested, and appropriate handling procedures should be followed. Overall, 2,4-diamino-1,3-benzenediol is a versatile compound with significant relevance in both industrial and research contexts.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c7-3-1-2-4(9)5(8)6(3)10/h1-2,9-10H,7-8H2
InChI key:InChIKey=RWAOPZVGICHCOI-UHFFFAOYSA-N
SMILES:NC1=C(O)C(N)=CC=C1O
Synonyms:- 1,3-Diamino-2,4-dihydroxybenzene
- 2,4-Diaminoresorcinol
- 2,4-Diamino-1,3-benzenediol
- 1,3-Benzenediol, 2,4-diamino-
- Resorcinol, 2,4-diamino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
