CAS 1306602-92-5

Benzeneacetic acid, α-(diethylamino)-3-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Benzeneacetic acid, α-(diethylamino)-3-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzene ring, an acetic acid moiety, and a diethylamino group, along with a trifluoromethyl substituent. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the trifluoromethyl group often imparts unique electronic and steric characteristics, potentially affecting the compound's reactivity and biological activity. As a hydrochloride, it is likely to exhibit improved stability and bioavailability compared to its free base form. The diethylamino group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may enhance interactions with biological targets. Overall, this compound's unique structural features make it of interest in various fields, including organic synthesis and drug development, although specific applications would depend on further research into its properties and effects.

Formula: C₁₃H₁₆F₃NO₂·ClH

InChI: InChI=1S/C13H16F3NO2.ClH/c1-3-17(4-2)11(12(18)19)9-6-5-7-10(8-9)13(14,15)16;/h5-8,11H,3-4H2,1-2H3,(H,18,19);1H

InChI key: InChIKey=CPGPSSRFDVUWLL-UHFFFAOYSA-N

SMILES: C(N(CC)CC)(C(O)=O)C1=CC(C(F)(F)F)=CC=C1.Cl

Synonyms:

• Benzeneacetic acid, α-(diethylamino)-3-(trifluoromethyl)-, hydrochloride (1:1)

2-(Diethylamino)-2-[3-(trifluoromethyl)phenyl]acetic acid hydrochloride

CAS: 1306602-92-5

Versatile small molecule scaffold

Formula: C₁₃H₁₇ClF₃NO₂

Purity: Min. 95%

Molecular weight: 311.73 g/mol

Ref: 3D-GCC60292