CAS 1306602-96-9

1-Piperazineacetamide, α-methyl-, hydrochloride (1:2)

Description:

1-Piperazineacetamide, α-methyl-, hydrochloride (1:2) is a chemical compound characterized by its piperazine and acetamide functional groups, which contribute to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the α-methyl group may influence its pharmacokinetic properties, such as absorption and metabolism. This compound is often studied for its potential therapeutic effects, particularly in the context of neurological or psychiatric disorders, due to the piperazine moiety, which is known for its interactions with various neurotransmitter receptors. Additionally, the hydrochloride form can provide stability and improved handling characteristics in laboratory settings. Safety data sheets and material safety data should be consulted for handling and toxicity information, as with any chemical substance. Overall, 1-Piperazineacetamide, α-methyl-, hydrochloride (1:2) represents a class of compounds with significant interest in medicinal chemistry.

Formula: C₇H₁₅N₃O·2ClH

InChI: InChI=1S/C7H15N3O.2ClH/c1-6(7(8)11)10-4-2-9-3-5-10;;/h6,9H,2-5H2,1H3,(H2,8,11);2*1H

InChI key: InChIKey=PTELSHBHNYBJCE-UHFFFAOYSA-N

SMILES: C(C(N)=O)(C)N1CCNCC1.Cl

Synonyms:

• 1-Piperazineacetamide, α-methyl-, hydrochloride (1:2)
• 2-(Piperazin-1-yl)propanamide dihydrochloride

2-(Piperazin-1-yl)propanamide dihydrochloride

CAS: 1306602-96-9

Versatile small molecule scaffold

Formula: C₇H₁₇Cl₂N₃O

Purity: Min. 95%

Molecular weight: 230.13 g/mol

Ref: 3D-GCC60296