
CAS 1306603-01-9
:5-Methyl-1-(1,2,3,4-tetrahydro-2-methyl-5-isoquinolinyl)-1H-1,2,3-triazole-4-carboxylic acid
Description:
5-Methyl-1-(1,2,3,4-tetrahydro-2-methyl-5-isoquinolinyl)-1H-1,2,3-triazole-4-carboxylic acid is a complex organic compound characterized by its unique structural features, which include a triazole ring and an isoquinoline moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the carboxylic acid functional group suggests acidic properties, which may influence its reactivity and interactions with biological targets. The methyl and tetrahydroisoquinoline substituents can contribute to its lipophilicity and overall molecular stability. Additionally, the compound may participate in hydrogen bonding due to the carboxylic acid and triazole functionalities, which can affect its pharmacokinetic properties. Overall, this compound's structural complexity and functional groups suggest potential applications in drug development, particularly in the search for novel therapeutic agents. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C14H16N4O2
InChI:InChI=1S/C14H16N4O2/c1-9-13(14(19)20)15-16-18(9)12-5-3-4-10-8-17(2)7-6-11(10)12/h3-5H,6-8H2,1-2H3,(H,19,20)
InChI key:InChIKey=KQITYCIVQNVHJH-UHFFFAOYSA-N
SMILES:CC=1N(C2=C3C(=CC=C2)CN(C)CC3)N=NC1C(O)=O
Synonyms:- 5-Methyl-1-(1,2,3,4-tetrahydro-2-methyl-5-isoquinolinyl)-1H-1,2,3-triazole-4-carboxylic acid
- 1H-1,2,3-Triazole-4-carboxylic acid, 5-methyl-1-(1,2,3,4-tetrahydro-2-methyl-5-isoquinolinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.