CymitQuimica logo

CAS 1306603-14-4

:

3-(Aminomethyl)-1,2,3,4-tetrahydro-5,7-dimethoxy-4-quinolinol

Description:
3-(Aminomethyl)-1,2,3,4-tetrahydro-5,7-dimethoxy-4-quinolinol is a chemical compound characterized by its complex structure, which includes a quinoline core with multiple functional groups. This substance features a tetrahydroquinoline framework, indicating it has a saturated ring system, which contributes to its potential biological activity. The presence of the aminomethyl group suggests it may engage in hydrogen bonding and participate in various chemical reactions, enhancing its reactivity. The dimethoxy substituents at the 5 and 7 positions of the quinoline ring can influence its solubility and interaction with biological targets. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a unique structure that may have applications in drug development or other chemical research fields.
Formula:C12H18N2O3
InChI:InChI=1S/C12H18N2O3/c1-16-8-3-9-11(10(4-8)17-2)12(15)7(5-13)6-14-9/h3-4,7,12,14-15H,5-6,13H2,1-2H3
InChI key:InChIKey=BAOYMHOOASNSOB-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(OC)=C1)NCC(CN)C2O
Synonyms:
  • 3-(Aminomethyl)-1,2,3,4-tetrahydro-5,7-dimethoxy-4-quinolinol
  • 4-Quinolinol, 3-(aminomethyl)-1,2,3,4-tetrahydro-5,7-dimethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.