CymitQuimica logo

CAS 1306603-26-8

:

2H-Thiopyran-3-carbonitrile, 4-amino-5,6-dihydro-, 1,1-dioxide

Description:
2H-Thiopyran-3-carbonitrile, 4-amino-5,6-dihydro-, 1,1-dioxide, identified by its CAS number 1306603-26-8, is a heterocyclic compound featuring a thiopyran ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound exhibits characteristics typical of thiopyran derivatives, including potential reactivity due to the presence of the carbonitrile and amino functional groups. The 1,1-dioxide designation indicates the presence of two oxygen atoms bonded to the sulfur atom, which can influence the compound's chemical reactivity and stability. The amino group suggests potential for hydrogen bonding and interaction with biological systems, making it of interest in medicinal chemistry. Additionally, the presence of the carbonitrile group may impart unique electronic properties, enhancing its utility in various chemical reactions. Overall, this compound's structural features suggest it may have applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C6H8N2O2S
InChI:InChI=1S/C6H8N2O2S/c7-3-5-4-11(9,10)2-1-6(5)8/h1-2,4,8H2
InChI key:InChIKey=MJQFXCQKNNKSDW-UHFFFAOYSA-N
SMILES:C(#N)C=1CS(=O)(=O)CCC1N
Synonyms:
  • 2H-Thiopyran-3-carbonitrile, 4-amino-5,6-dihydro-, 1,1-dioxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.