CAS 1306603-67-7

4-Thiazolemethanamine, α-methyl-2-(1-methylethyl)-, hydrochloride (1:2)

Description:

4-Thiazolemethanamine, α-methyl-2-(1-methylethyl)-, hydrochloride (1:2) is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity. This compound typically appears as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The presence of the α-methyl and isopropyl groups indicates that it may exhibit unique steric and electronic properties, potentially influencing its interaction with biological targets. The thiazole moiety is known for its role in various biological processes, and compounds containing this structure often exhibit antimicrobial, antifungal, or anticancer activities. The hydrochloride form is commonly used to improve the stability and bioavailability of the compound. As with many thiazole derivatives, the compound may also participate in hydrogen bonding and other intermolecular interactions, which can affect its reactivity and solubility. Overall, this compound's characteristics make it of interest in medicinal chemistry and related fields.

Formula: C₈H₁₄N₂S·2ClH

InChI: InChI=1S/C8H14N2S.2ClH/c1-5(2)8-10-7(4-11-8)6(3)9;;/h4-6H,9H2,1-3H3;2*1H

InChI key: InChIKey=RWYOZNHMIHGARZ-UHFFFAOYSA-N

SMILES: C(C)(N)C=1N=C(C(C)C)SC1.Cl

Synonyms:

• 4-Thiazolemethanamine, α-methyl-2-(1-methylethyl)-, hydrochloride (1:2)

1-[2-(Propan-2-yl)-1,3-thiazol-4-yl]ethan-1-amine dihydrochloride

CAS: 1306603-67-7

Versatile small molecule scaffold

Formula: C₈H₁₆Cl₂N₂S

Purity: Min. 95%

Molecular weight: 243.2 g/mol

Ref: 3D-GCC60367