CymitQuimica logo

CAS 1306603-72-4

:

5-Butoxy-6-methoxy-1H-indazole-3-acetic acid

Description:
5-Butoxy-6-methoxy-1H-indazole-3-acetic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features a butoxy group and a methoxy group, contributing to its hydrophobic and hydrophilic properties, respectively. The presence of the acetic acid moiety indicates that it has acidic characteristics, which may influence its solubility and reactivity in various environments. Typically, compounds like this may exhibit biological activity, potentially interacting with specific receptors or enzymes, making them of interest in pharmaceutical research. The molecular structure suggests that it could participate in hydrogen bonding due to the presence of the carboxylic acid group, which may enhance its solubility in polar solvents. Additionally, the butoxy and methoxy substituents can affect the compound's lipophilicity, influencing its absorption and distribution in biological systems. Overall, this compound's unique structural features may contribute to its potential applications in medicinal chemistry and drug development.
Formula:C14H18N2O4
InChI:InChI=1S/C14H18N2O4/c1-3-4-5-20-13-6-9-10(7-12(13)19-2)15-16-11(9)8-14(17)18/h6-7H,3-5,8H2,1-2H3,(H,15,16)(H,17,18)
InChI key:InChIKey=VVGZBZWGAAPKCU-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=2C(=CC(OC)=C(OCCCC)C2)NN1
Synonyms:
  • 1H-Indazole-3-acetic acid, 5-butoxy-6-methoxy-
  • 5-Butoxy-6-methoxy-1H-indazole-3-acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.