
CAS 1306603-77-9
:4-Bromo-2H-indazole-3-acetic acid
Description:
4-Bromo-2H-indazole-3-acetic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 4-position of the indazole ring contributes to its reactivity and potential biological activity. The acetic acid functional group at the 3-position introduces acidity and polar characteristics, enhancing its solubility in polar solvents. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could be explored in therapeutic contexts. Additionally, the compound's stability, solubility, and reactivity can be influenced by the bromine substituent and the carboxylic acid group, making it a subject of study in synthetic and medicinal chemistry. As with many chemical substances, safety and handling precautions should be observed due to potential hazards associated with brominated compounds.
Formula:C9H7BrN2O2
InChI:InChI=1S/C9H7BrN2O2/c10-5-2-1-3-6-9(5)7(12-11-6)4-8(13)14/h1-3H,4H2,(H,11,12)(H,13,14)
InChI key:InChIKey=WYICAWXWQIJQEN-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C2C(=NN1)C=CC=C2Br
Synonyms:- 2H-Indazole-3-acetic acid, 4-bromo-
- 4-Bromo-2H-indazole-3-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.