CAS 1306604-00-1

3,5-Dichloro-4-[3-(trifluoromethyl)-1H-pyrazol-1-yl]benzenamine

Description:

3,5-Dichloro-4-[3-(trifluoromethyl)-1H-pyrazol-1-yl]benzenamine is a chemical compound characterized by its complex structure, which includes a dichlorobenzene moiety and a trifluoromethyl-substituted pyrazole. This compound features two chlorine atoms attached to the benzene ring at the 3 and 5 positions, enhancing its reactivity and potential applications in various chemical reactions. The presence of the trifluoromethyl group contributes to its lipophilicity and may influence its biological activity. The pyrazole ring, known for its diverse pharmacological properties, adds to the compound's potential as a pharmaceutical agent. This substance is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals. Its unique combination of functional groups may impart specific properties, such as increased stability or selectivity in biological systems. Safety and handling precautions are essential due to the presence of halogenated compounds, which can pose environmental and health risks.

Formula: C₁₀H₆Cl₂F₃N₃

InChI: InChI=1S/C10H6Cl2F3N3/c11-6-3-5(16)4-7(12)9(6)18-2-1-8(17-18)10(13,14)15/h1-4H,16H2

InChI key: InChIKey=DQMOQAFPBRJDNY-UHFFFAOYSA-N

SMILES: ClC1=C(N2N=C(C(F)(F)F)C=C2)C(Cl)=CC(N)=C1

Synonyms:

• Benzenamine, 3,5-dichloro-4-[3-(trifluoromethyl)-1H-pyrazol-1-yl]-
• 3,5-Dichloro-4-[3-(trifluoromethyl)-1H-pyrazol-1-yl]benzenamine