CymitQuimica logo

CAS 1306604-09-0

:

δ,δ-Dimethylcyclohexanebutanamine

Description:
δ,δ-Dimethylcyclohexanebutanamine is an organic compound characterized by its unique structure, which includes a cyclohexane ring substituted with two methyl groups and a butanamine chain. This compound falls under the category of amines, which are known for their basicity and ability to form hydrogen bonds due to the presence of a nitrogen atom. The presence of the cyclohexane ring contributes to its hydrophobic characteristics, while the amine functional group can engage in polar interactions. Typically, such compounds may exhibit moderate solubility in organic solvents and limited solubility in water, depending on the size and nature of the substituents. The compound's specific properties, such as boiling point, melting point, and reactivity, would depend on its molecular structure and the arrangement of its substituents. δ,δ-Dimethylcyclohexanebutanamine may have applications in various fields, including pharmaceuticals and materials science, due to its potential biological activity and structural versatility. However, detailed studies would be necessary to fully understand its behavior and applications.
Formula:C12H25N
InChI:InChI=1S/C12H25N/c1-12(2,9-6-10-13)11-7-4-3-5-8-11/h11H,3-10,13H2,1-2H3
InChI key:InChIKey=VXZUFDZEHJKZJF-UHFFFAOYSA-N
SMILES:C(CCCN)(C)(C)C1CCCCC1
Synonyms:
  • Cyclohexanebutanamine, δ,δ-dimethyl-
  • δ,δ-Dimethylcyclohexanebutanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.