CAS 1306604-19-2

Ethanesulfonamide, 2-amino-N-[(tetrahydro-2H-pyran-2-yl)methyl]-, hydrochloride (1:1)

Description:

Ethanesulfonamide, 2-amino-N-[(tetrahydro-2H-pyran-2-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the amino group contributes to its potential biological activity, while the tetrahydro-2H-pyran moiety may enhance its lipophilicity and ability to penetrate biological membranes. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in pharmaceutical formulations. This compound may exhibit properties such as moderate to high stability under standard conditions, and its structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutics targeting various diseases. The specific interactions and efficacy of this compound would depend on its molecular conformation and the presence of substituents, which can influence its pharmacokinetics and pharmacodynamics. Overall, this compound represents a class of sulfonamide derivatives that may have significant implications in drug development and therapeutic applications.

Formula: C₈H₁₈N₂O₃S·ClH

InChI: InChI=1S/C8H18N2O3S.ClH/c9-4-6-14(11,12)10-7-8-3-1-2-5-13-8;/h8,10H,1-7,9H2;1H

InChI key: InChIKey=YWWSHAJCIBYKBM-UHFFFAOYSA-N

SMILES: C(NS(CCN)(=O)=O)C1CCCCO1.Cl

Synonyms:

• Ethanesulfonamide, 2-amino-N-[(tetrahydro-2H-pyran-2-yl)methyl]-, hydrochloride (1:1)

2-Amino-N-(oxan-2-ylmethyl)ethane-1-sulfonamide hydrochloride

CAS: 1306604-19-2

Versatile small molecule scaffold

Formula: C₈H₁₉ClN₂O₃S

Purity: Min. 95%

Molecular weight: 258.77 g/mol

Ref: 3D-GCC60419