CAS 1306604-31-8

4-(Tetrahydro-1,1-dioxido-2-thienyl)piperidine

Description:

4-(Tetrahydro-1,1-dioxido-2-thienyl)piperidine is a chemical compound characterized by its unique structural features, which include a piperidine ring and a tetrahydro-1,1-dioxido-2-thienyl group. The presence of the dioxido group suggests that the compound may exhibit interesting reactivity and stability due to the potential for electron donation or withdrawal. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic characteristics and may influence its electronic properties and interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for further investigation in various chemical and biological applications. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for practical applications.

Formula: C₉H₁₇NO₂S

InChI: InChI=1S/C9H17NO2S/c11-13(12)7-1-2-9(13)8-3-5-10-6-4-8/h8-10H,1-7H2

InChI key: InChIKey=CUVAAAFYMPZIIH-UHFFFAOYSA-N

SMILES: O=S1(=O)C(C2CCNCC2)CCC1

Synonyms:

• Piperidine, 4-(tetrahydro-1,1-dioxido-2-thienyl)-
• 4-(Tetrahydro-1,1-dioxido-2-thienyl)piperidine