
CAS 1306604-41-0
:5-Bromo-1,2,3,4-tetrahydro-6,7-dimethoxyisoquinoline
Description:
5-Bromo-1,2,3,4-tetrahydro-6,7-dimethoxyisoquinoline is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound featuring a fused benzene and pyridine ring. The presence of the bromine atom at the 5-position and two methoxy groups at the 6 and 7 positions contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its tetrahydro configuration indicates that it has undergone partial hydrogenation, which can influence its pharmacological properties. The methoxy groups can enhance lipophilicity, potentially affecting its interaction with biological membranes. Compounds of this type are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. As with many organic compounds, safety and handling precautions should be observed, as the bromine substituent may impart toxicity or reactivity under certain conditions.
Formula:C11H14BrNO2
InChI:InChI=1S/C11H14BrNO2/c1-14-9-5-7-6-13-4-3-8(7)10(12)11(9)15-2/h5,13H,3-4,6H2,1-2H3
InChI key:InChIKey=VTDGZPKGEUXCPY-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(OC)=C1OC)CNCC2
Synonyms:- Isoquinoline, 5-bromo-1,2,3,4-tetrahydro-6,7-dimethoxy-
- 5-Bromo-1,2,3,4-tetrahydro-6,7-dimethoxyisoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.